C35H36N4O7S — CID 135742662
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidoyl]amino]phenyl]propanoic acid (PubChem CID 135742662) has the molecular formula C35H36N4O7S and a molecular weight of 656.76 g/mol. Its IUPAC name is (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidoyl]amino]phenyl]propanoic acid.
| Compound Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidoyl]amino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 135742662 |
| Molecular Formula | C35H36N4O7S |
| Molecular Weight | 656.76 g/mol |
| Exact Mass | 656.23 |
| IUPAC Name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[4-[[N'-(4-methoxy-2,3,6-trimethylphenyl)sulfonylcarbamimidoyl]amino]phenyl]propanoic acid |
| SMILES | COc1cc(C)c(S(=O)(=O)N=C(N)Nc2ccc(C[C@H](NC(=O)OCC3c4ccccc4-c4ccccc43)C(=O)O)cc2)c(C)c1C |
| InChI | InChI=1S/C35H36N4O7S/c1-20-17-31(45-4)21(2)22(3)32(20)47(43,44)39-34(36)37-24-15-13-23(14-16-24)18-30(33(40)41)38-35(42)46-19-29-27-11-7-5-9-25(27)26-10-6-8-12-28(26)29/h5-17,29-30H,18-19H2,1-4H3,(H,38,42)(H,40,41)(H3,36,37,39)/t30-/m0/s1 |
| InChIKey | WGBKYCGAMXBSSF-PMERELPUSA-N |
| XLogP | 5.27 |
| TPSA | 169.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|