C21H14Cl3F2N3O7S — CID 142989219
N-[5-[[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylamino]-2-(fluoromethoxy)phenyl]-2-fluoroacetamide (PubChem CID 142989219) has the molecular formula C21H14Cl3F2N3O7S and a molecular weight of 596.78 g/mol. Its IUPAC name is N-[5-[[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylamino]-2-(fluoromethoxy)phenyl]-2-fluoroacetamide.
| Compound Name | N-[5-[[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylamino]-2-(fluoromethoxy)phenyl]-2-fluoroacetamide |
|---|---|
| PubChem CID | 142989219 |
| Molecular Formula | C21H14Cl3F2N3O7S |
| Molecular Weight | 596.78 g/mol |
| Exact Mass | 594.96 |
| IUPAC Name | N-[5-[[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylamino]-2-(fluoromethoxy)phenyl]-2-fluoroacetamide |
| SMILES | O=C(CF)Nc1cc(NS(=O)(=O)c2cc(Cl)c(Oc3ccc([N+](=O)[O-])cc3Cl)c(Cl)c2)ccc1OCF |
| InChI | InChI=1S/C21H14Cl3F2N3O7S/c22-14-6-12(29(31)32)2-4-18(14)36-21-15(23)7-13(8-16(21)24)37(33,34)28-11-1-3-19(35-10-26)17(5-11)27-20(30)9-25/h1-8,28H,9-10H2,(H,27,30) |
| InChIKey | XWUFAVLKGMDGCT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.78 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|