C21H14Cl3N3O5S — CID 59982329
3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-(2-methyl-1H-indol-5-yl)benzenesulfonamide (PubChem CID 59982329) has the molecular formula C21H14Cl3N3O5S and a molecular weight of 526.79 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-(2-methyl-1H-indol-5-yl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-(2-methyl-1H-indol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 59982329 |
| Molecular Formula | C21H14Cl3N3O5S |
| Molecular Weight | 526.79 g/mol |
| Exact Mass | 524.97 |
| IUPAC Name | 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-(2-methyl-1H-indol-5-yl)benzenesulfonamide |
| SMILES | Cc1cc2cc(NS(=O)(=O)c3cc(Cl)c(Oc4ccc([N+](=O)[O-])cc4Cl)c(Cl)c3)ccc2[nH]1 |
| InChI | InChI=1S/C21H14Cl3N3O5S/c1-11-6-12-7-13(2-4-19(12)25-11)26-33(30,31)15-9-17(23)21(18(24)10-15)32-20-5-3-14(27(28)29)8-16(20)22/h2-10,25-26H,1H3 |
| InChIKey | XDJINDBETVTRPK-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 114.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.79 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|