C16H13Cl3N2O5S — CID 2798215
1-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylpyrrolidine (PubChem CID 2798215) has the molecular formula C16H13Cl3N2O5S and a molecular weight of 451.72 g/mol. Its IUPAC name is 1-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylpyrrolidine.
| Compound Name | 1-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylpyrrolidine |
|---|---|
| PubChem CID | 2798215 |
| Molecular Formula | C16H13Cl3N2O5S |
| Molecular Weight | 451.72 g/mol |
| Exact Mass | 449.96 |
| IUPAC Name | 1-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylpyrrolidine |
| SMILES | O=[N+]([O-])c1ccc(Oc2c(Cl)cc(S(=O)(=O)N3CCCC3)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl3N2O5S/c17-12-7-10(21(22)23)3-4-15(12)26-16-13(18)8-11(9-14(16)19)27(24,25)20-5-1-2-6-20/h3-4,7-9H,1-2,5-6H2 |
| InChIKey | NLWDBCKIODIXDT-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.72 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|