C21H20Cl3N3O6S — CID 67046109
(2S)-N-(cyclopropylmethyl)-1-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylpyrrolidine-2-carboxamide (PubChem CID 67046109) has the molecular formula C21H20Cl3N3O6S and a molecular weight of 548.83 g/mol. Its IUPAC name is (2S)-N-(cyclopropylmethyl)-1-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(cyclopropylmethyl)-1-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67046109 |
| Molecular Formula | C21H20Cl3N3O6S |
| Molecular Weight | 548.83 g/mol |
| Exact Mass | 547.01 |
| IUPAC Name | (2S)-N-(cyclopropylmethyl)-1-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(NCC1CC1)[C@@H]1CCCN1S(=O)(=O)c1cc(Cl)c(Oc2ccc([N+](=O)[O-])cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C21H20Cl3N3O6S/c22-15-8-13(27(29)30)5-6-19(15)33-20-16(23)9-14(10-17(20)24)34(31,32)26-7-1-2-18(26)21(28)25-11-12-3-4-12/h5-6,8-10,12,18H,1-4,7,11H2,(H,25,28)/t18-/m0/s1 |
| InChIKey | XOMWSWTZUKUAIV-SFHVURJKSA-N |
| XLogP | 5.03 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.83 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|