C15H23ClN4O5S — CID 119497101
N-(3-aminobutyl)-1-(3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119497101) has the molecular formula C15H23ClN4O5S and a molecular weight of 406.89 g/mol. Its IUPAC name is N-(3-aminobutyl)-1-(3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminobutyl)-1-(3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119497101 |
| Molecular Formula | C15H23ClN4O5S |
| Molecular Weight | 406.89 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(3-aminobutyl)-1-(3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide;hydrochloride |
| SMILES | CC(N)CCNC(=O)C1CCCN1S(=O)(=O)c1cccc([N+](=O)[O-])c1.Cl |
| InChI | InChI=1S/C15H22N4O5S.ClH/c1-11(16)7-8-17-15(20)14-6-3-9-18(14)25(23,24)13-5-2-4-12(10-13)19(21)22;/h2,4-5,10-11,14H,3,6-9,16H2,1H3,(H,17,20);1H |
| InChIKey | CXVCZKXDKHQJMR-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.89 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|