C17H25ClN4O5S — CID 119561779
[4-(methylamino)piperidin-1-yl]-[1-(3-nitrophenyl)sulfonylpyrrolidin-2-yl]methanone;hydrochloride (PubChem CID 119561779) has the molecular formula C17H25ClN4O5S and a molecular weight of 432.93 g/mol. Its IUPAC name is [4-(methylamino)piperidin-1-yl]-[1-(3-nitrophenyl)sulfonylpyrrolidin-2-yl]methanone;hydrochloride.
| Compound Name | [4-(methylamino)piperidin-1-yl]-[1-(3-nitrophenyl)sulfonylpyrrolidin-2-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 119561779 |
| Molecular Formula | C17H25ClN4O5S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | [4-(methylamino)piperidin-1-yl]-[1-(3-nitrophenyl)sulfonylpyrrolidin-2-yl]methanone;hydrochloride |
| SMILES | CNC1CCN(C(=O)C2CCCN2S(=O)(=O)c2cccc([N+](=O)[O-])c2)CC1.Cl |
| InChI | InChI=1S/C17H24N4O5S.ClH/c1-18-13-7-10-19(11-8-13)17(22)16-6-3-9-20(16)27(25,26)15-5-2-4-14(12-15)21(23)24;/h2,4-5,12-13,16,18H,3,6-11H2,1H3;1H |
| InChIKey | IGOQVTDPAHXUGX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|