C12H15N2O5S+ — CID 7063075
[3-[(2R)-2-carboxypyrrolidin-1-yl]sulfonylphenyl]-methyl-oxoazanium (PubChem CID 7063075) has the molecular formula C12H15N2O5S+ and a molecular weight of 299.33 g/mol. Its IUPAC name is [3-[(2R)-2-carboxypyrrolidin-1-yl]sulfonylphenyl]-methyl-oxoazanium.
| Compound Name | [3-[(2R)-2-carboxypyrrolidin-1-yl]sulfonylphenyl]-methyl-oxoazanium |
|---|---|
| PubChem CID | 7063075 |
| Molecular Formula | C12H15N2O5S+ |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | [3-[(2R)-2-carboxypyrrolidin-1-yl]sulfonylphenyl]-methyl-oxoazanium |
| SMILES | C[N+](=O)c1cccc(S(=O)(=O)N2CCC[C@@H]2C(=O)O)c1 |
| InChI | InChI=1S/C12H14N2O5S/c1-13(17)9-4-2-5-10(8-9)20(18,19)14-7-3-6-11(14)12(15)16/h2,4-5,8,11H,3,6-7H2,1H3/p+1/t11-/m1/s1 |
| InChIKey | GQAJWVCFHDRARN-LLVKDONJSA-O |
| XLogP | 0.96 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|