C17H25ClN4O5S — CID 119602784
N-[2-(aminomethyl)cyclopentyl]-1-(3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide;hydrochloride (PubChem CID 119602784) has the molecular formula C17H25ClN4O5S and a molecular weight of 432.93 g/mol. Its IUPAC name is N-[2-(aminomethyl)cyclopentyl]-1-(3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(aminomethyl)cyclopentyl]-1-(3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119602784 |
| Molecular Formula | C17H25ClN4O5S |
| Molecular Weight | 432.93 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[2-(aminomethyl)cyclopentyl]-1-(3-nitrophenyl)sulfonylpyrrolidine-2-carboxamide;hydrochloride |
| SMILES | Cl.NCC1CCCC1NC(=O)C1CCCN1S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H24N4O5S.ClH/c18-11-12-4-1-7-15(12)19-17(22)16-8-3-9-20(16)27(25,26)14-6-2-5-13(10-14)21(23)24;/h2,5-6,10,12,15-16H,1,3-4,7-9,11,18H2,(H,19,22);1H |
| InChIKey | ISKBLNMTBYZGSY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.93 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|