C18H17Cl3N2O6S — CID 6976469
(2S,6R)-4-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonyl-2,6-dimethylmorpholine (PubChem CID 6976469) has the molecular formula C18H17Cl3N2O6S and a molecular weight of 495.77 g/mol. Its IUPAC name is (2S,6R)-4-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonyl-2,6-dimethylmorpholine.
| Compound Name | (2S,6R)-4-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonyl-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 6976469 |
| Molecular Formula | C18H17Cl3N2O6S |
| Molecular Weight | 495.77 g/mol |
| Exact Mass | 493.99 |
| IUPAC Name | (2S,6R)-4-[3,5-dichloro-4-(2-chloro-4-nitrophenoxy)phenyl]sulfonyl-2,6-dimethylmorpholine |
| SMILES | C[C@@H]1CN(S(=O)(=O)c2cc(Cl)c(Oc3ccc([N+](=O)[O-])cc3Cl)c(Cl)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H17Cl3N2O6S/c1-10-8-22(9-11(2)28-10)30(26,27)13-6-15(20)18(16(21)7-13)29-17-4-3-12(23(24)25)5-14(17)19/h3-7,10-11H,8-9H2,1-2H3/t10-,11+ |
| InChIKey | AOOYUYSVKYMNDD-PHIMTYICSA-N |
| XLogP | 5.15 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.77 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|