C19H13Cl3N2O7S2 — CID 59982386
3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-(3-methylsulfonylphenyl)benzenesulfonamide (PubChem CID 59982386) has the molecular formula C19H13Cl3N2O7S2 and a molecular weight of 551.81 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-(3-methylsulfonylphenyl)benzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-(3-methylsulfonylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 59982386 |
| Molecular Formula | C19H13Cl3N2O7S2 |
| Molecular Weight | 551.81 g/mol |
| Exact Mass | 549.92 |
| IUPAC Name | 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-(3-methylsulfonylphenyl)benzenesulfonamide |
| SMILES | CS(=O)(=O)c1cccc(NS(=O)(=O)c2cc(Cl)c(Oc3ccc([N+](=O)[O-])cc3Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C19H13Cl3N2O7S2/c1-32(27,28)13-4-2-3-11(7-13)23-33(29,30)14-9-16(21)19(17(22)10-14)31-18-6-5-12(24(25)26)8-15(18)20/h2-10,23H,1H3 |
| InChIKey | JTBWLRJPXKZRCM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.81 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|