C17H10Cl3N3O5S — CID 59982411
3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-pyridin-3-ylbenzenesulfonamide (PubChem CID 59982411) has the molecular formula C17H10Cl3N3O5S and a molecular weight of 474.71 g/mol. Its IUPAC name is 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-pyridin-3-ylbenzenesulfonamide.
| Compound Name | 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-pyridin-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 59982411 |
| Molecular Formula | C17H10Cl3N3O5S |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 472.94 |
| IUPAC Name | 3,5-dichloro-4-(2-chloro-4-nitrophenoxy)-N-pyridin-3-ylbenzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Oc2c(Cl)cc(S(=O)(=O)Nc3cccnc3)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H10Cl3N3O5S/c18-13-6-11(23(24)25)3-4-16(13)28-17-14(19)7-12(8-15(17)20)29(26,27)22-10-2-1-5-21-9-10/h1-9,22H |
| InChIKey | VQDULBDEMGFJOF-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|