C24H13BrCl3IN2O6S — CID 59982364
N-[3-bromo-4-(4-iodophenoxy)phenyl]-3,5-dichloro-4-(2-chloro-4-nitrophenoxy)benzenesulfonamide (PubChem CID 59982364) has the molecular formula C24H13BrCl3IN2O6S and a molecular weight of 770.61 g/mol. Its IUPAC name is N-[3-bromo-4-(4-iodophenoxy)phenyl]-3,5-dichloro-4-(2-chloro-4-nitrophenoxy)benzenesulfonamide.
| Compound Name | N-[3-bromo-4-(4-iodophenoxy)phenyl]-3,5-dichloro-4-(2-chloro-4-nitrophenoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 59982364 |
| Molecular Formula | C24H13BrCl3IN2O6S |
| Molecular Weight | 770.61 g/mol |
| Exact Mass | 767.78 |
| IUPAC Name | N-[3-bromo-4-(4-iodophenoxy)phenyl]-3,5-dichloro-4-(2-chloro-4-nitrophenoxy)benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(Oc2c(Cl)cc(S(=O)(=O)Nc3ccc(Oc4ccc(I)cc4)c(Br)c3)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H13BrCl3IN2O6S/c25-18-9-14(3-7-22(18)36-16-5-1-13(29)2-6-16)30-38(34,35)17-11-20(27)24(21(28)12-17)37-23-8-4-15(31(32)33)10-19(23)26/h1-12,30H |
| InChIKey | VXCFAAKLULOSMX-UHFFFAOYSA-N |
| XLogP | 9.31 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.61 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|