C21H16Cl2N4O4 — CID 91466610
4-(2,6-dichloro-4-nitrophenoxy)-5-[(4-methoxyphenyl)methyl]-3-methyl-2H-pyrazolo[3,4-b]pyridine (PubChem CID 91466610) has the molecular formula C21H16Cl2N4O4 and a molecular weight of 459.29 g/mol. Its IUPAC name is 4-(2,6-dichloro-4-nitrophenoxy)-5-[(4-methoxyphenyl)methyl]-3-methyl-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 4-(2,6-dichloro-4-nitrophenoxy)-5-[(4-methoxyphenyl)methyl]-3-methyl-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 91466610 |
| Molecular Formula | C21H16Cl2N4O4 |
| Molecular Weight | 459.29 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | 4-(2,6-dichloro-4-nitrophenoxy)-5-[(4-methoxyphenyl)methyl]-3-methyl-2H-pyrazolo[3,4-b]pyridine |
| SMILES | COc1ccc(Cc2cnc3n[nH]c(C)c3c2Oc2c(Cl)cc([N+](=O)[O-])cc2Cl)cc1 |
| InChI | InChI=1S/C21H16Cl2N4O4/c1-11-18-19(31-20-16(22)8-14(27(28)29)9-17(20)23)13(10-24-21(18)26-25-11)7-12-3-5-15(30-2)6-4-12/h3-6,8-10H,7H2,1-2H3,(H,24,25,26) |
| InChIKey | SXFMVRCXJYWYLZ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.29 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|