C20H17Cl2NO2 — CID 129199019
4-(3-benzyl-4-methoxyphenoxy)-3,5-dichloroaniline (PubChem CID 129199019) has the molecular formula C20H17Cl2NO2 and a molecular weight of 374.27 g/mol. Its IUPAC name is 4-(3-benzyl-4-methoxyphenoxy)-3,5-dichloroaniline.
| Compound Name | 4-(3-benzyl-4-methoxyphenoxy)-3,5-dichloroaniline |
|---|---|
| PubChem CID | 129199019 |
| Molecular Formula | C20H17Cl2NO2 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 4-(3-benzyl-4-methoxyphenoxy)-3,5-dichloroaniline |
| SMILES | COc1ccc(Oc2c(Cl)cc(N)cc2Cl)cc1Cc1ccccc1 |
| InChI | InChI=1S/C20H17Cl2NO2/c1-24-19-8-7-16(10-14(19)9-13-5-3-2-4-6-13)25-20-17(21)11-15(23)12-18(20)22/h2-8,10-12H,9,23H2,1H3 |
| InChIKey | VYSTWWYGNFUJCP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|