C24H22Cl2FNO5 — CID 166762395
N-[3,5-dichloro-4-[3-[(4-fluorophenyl)methyl]-4-methoxyphenoxy]phenyl]-2-ethoxy-2-hydroxyacetamide (PubChem CID 166762395) has the molecular formula C24H22Cl2FNO5 and a molecular weight of 494.35 g/mol. Its IUPAC name is N-[3,5-dichloro-4-[3-[(4-fluorophenyl)methyl]-4-methoxyphenoxy]phenyl]-2-ethoxy-2-hydroxyacetamide.
| Compound Name | N-[3,5-dichloro-4-[3-[(4-fluorophenyl)methyl]-4-methoxyphenoxy]phenyl]-2-ethoxy-2-hydroxyacetamide |
|---|---|
| PubChem CID | 166762395 |
| Molecular Formula | C24H22Cl2FNO5 |
| Molecular Weight | 494.35 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[3,5-dichloro-4-[3-[(4-fluorophenyl)methyl]-4-methoxyphenoxy]phenyl]-2-ethoxy-2-hydroxyacetamide |
| SMILES | CCOC(O)C(=O)Nc1cc(Cl)c(Oc2ccc(OC)c(Cc3ccc(F)cc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C24H22Cl2FNO5/c1-3-32-24(30)23(29)28-17-12-19(25)22(20(26)13-17)33-18-8-9-21(31-2)15(11-18)10-14-4-6-16(27)7-5-14/h4-9,11-13,24,30H,3,10H2,1-2H3,(H,28,29) |
| InChIKey | UWVFQMLEIBDEBD-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.35 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|