C22H18Cl2N2O5 — CID 129210822
N-[3,5-dichloro-4-[4-hydroxy-3-[(4-methylphenyl)methyl]phenoxy]phenyl]-N'-hydroxyoxamide (PubChem CID 129210822) has the molecular formula C22H18Cl2N2O5 and a molecular weight of 461.30 g/mol. Its IUPAC name is N-[3,5-dichloro-4-[4-hydroxy-3-[(4-methylphenyl)methyl]phenoxy]phenyl]-N'-hydroxyoxamide.
| Compound Name | N-[3,5-dichloro-4-[4-hydroxy-3-[(4-methylphenyl)methyl]phenoxy]phenyl]-N'-hydroxyoxamide |
|---|---|
| PubChem CID | 129210822 |
| Molecular Formula | C22H18Cl2N2O5 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | N-[3,5-dichloro-4-[4-hydroxy-3-[(4-methylphenyl)methyl]phenoxy]phenyl]-N'-hydroxyoxamide |
| SMILES | Cc1ccc(Cc2cc(Oc3c(Cl)cc(NC(=O)C(=O)NO)cc3Cl)ccc2O)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O5/c1-12-2-4-13(5-3-12)8-14-9-16(6-7-19(14)27)31-20-17(23)10-15(11-18(20)24)25-21(28)22(29)26-30/h2-7,9-11,27,30H,8H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | ZQGABQOVARSTQO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|