C27H26Cl2N2O5 — CID 18614227
2-[3,5-dichloro-4-[4-hydroxy-3-[(3-methyl-3-phenylpiperidin-1-yl)methyl]phenoxy]anilino]-2-oxoacetic acid (PubChem CID 18614227) has the molecular formula C27H26Cl2N2O5 and a molecular weight of 529.42 g/mol. Its IUPAC name is 2-[3,5-dichloro-4-[4-hydroxy-3-[(3-methyl-3-phenylpiperidin-1-yl)methyl]phenoxy]anilino]-2-oxoacetic acid.
| Compound Name | 2-[3,5-dichloro-4-[4-hydroxy-3-[(3-methyl-3-phenylpiperidin-1-yl)methyl]phenoxy]anilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614227 |
| Molecular Formula | C27H26Cl2N2O5 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 2-[3,5-dichloro-4-[4-hydroxy-3-[(3-methyl-3-phenylpiperidin-1-yl)methyl]phenoxy]anilino]-2-oxoacetic acid |
| SMILES | CC1(c2ccccc2)CCCN(Cc2cc(Oc3c(Cl)cc(NC(=O)C(=O)O)cc3Cl)ccc2O)C1 |
| InChI | InChI=1S/C27H26Cl2N2O5/c1-27(18-6-3-2-4-7-18)10-5-11-31(16-27)15-17-12-20(8-9-23(17)32)36-24-21(28)13-19(14-22(24)29)30-25(33)26(34)35/h2-4,6-9,12-14,32H,5,10-11,15-16H2,1H3,(H,30,33)(H,34,35) |
| InChIKey | YFGSOEYEEFDRKF-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|