C19H19ClN2O8S — CID 18614122
2-[3-chloro-4-(4-hydroxy-3-morpholin-4-ylsulfonylphenoxy)-5-methylanilino]-2-oxoacetic acid (PubChem CID 18614122) has the molecular formula C19H19ClN2O8S and a molecular weight of 470.89 g/mol. Its IUPAC name is 2-[3-chloro-4-(4-hydroxy-3-morpholin-4-ylsulfonylphenoxy)-5-methylanilino]-2-oxoacetic acid.
| Compound Name | 2-[3-chloro-4-(4-hydroxy-3-morpholin-4-ylsulfonylphenoxy)-5-methylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614122 |
| Molecular Formula | C19H19ClN2O8S |
| Molecular Weight | 470.89 g/mol |
| Exact Mass | 470.06 |
| IUPAC Name | 2-[3-chloro-4-(4-hydroxy-3-morpholin-4-ylsulfonylphenoxy)-5-methylanilino]-2-oxoacetic acid |
| SMILES | Cc1cc(NC(=O)C(=O)O)cc(Cl)c1Oc1ccc(O)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H19ClN2O8S/c1-11-8-12(21-18(24)19(25)26)9-14(20)17(11)30-13-2-3-15(23)16(10-13)31(27,28)22-4-6-29-7-5-22/h2-3,8-10,23H,4-7H2,1H3,(H,21,24)(H,25,26) |
| InChIKey | JFSQKAUXAYIQFK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.89 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|