C22H26N2O9S2 — CID 10119068
ethyl 2-[4-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate (PubChem CID 10119068) has the molecular formula C22H26N2O9S2 and a molecular weight of 526.59 g/mol. Its IUPAC name is ethyl 2-[4-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 10119068 |
| Molecular Formula | C22H26N2O9S2 |
| Molecular Weight | 526.59 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | ethyl 2-[4-[3-[(1,1-dioxo-1,4-thiazinan-4-yl)sulfonyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc(O)c(S(=O)(=O)N3CCS(=O)(=O)CC3)c2)c(C)c1 |
| InChI | InChI=1S/C22H26N2O9S2/c1-4-32-22(27)21(26)23-16-11-14(2)20(15(3)12-16)33-17-5-6-18(25)19(13-17)35(30,31)24-7-9-34(28,29)10-8-24/h5-6,11-13,25H,4,7-10H2,1-3H3,(H,23,26) |
| InChIKey | WNQVQWITUCVARB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.59 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|