C27H28N2O6 — CID 59041690
ethyl 2-[4-[3-[(N-acetylanilino)methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate (PubChem CID 59041690) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is ethyl 2-[4-[3-[(N-acetylanilino)methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[3-[(N-acetylanilino)methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 59041690 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | ethyl 2-[4-[3-[(N-acetylanilino)methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc(O)c(CN(C(C)=O)c3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C27H28N2O6/c1-5-34-27(33)26(32)28-21-13-17(2)25(18(3)14-21)35-23-11-12-24(31)20(15-23)16-29(19(4)30)22-9-7-6-8-10-22/h6-15,31H,5,16H2,1-4H3,(H,28,32) |
| InChIKey | DVNFGVSGNHVJFY-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|