C33H42N2O7 — CID 59041743
ethyl 2-[4-[3-[[benzyl-[3-methoxy-2-(methoxymethyl)-2-methylpropyl]amino]methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate (PubChem CID 59041743) has the molecular formula C33H42N2O7 and a molecular weight of 578.71 g/mol. Its IUPAC name is ethyl 2-[4-[3-[[benzyl-[3-methoxy-2-(methoxymethyl)-2-methylpropyl]amino]methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[3-[[benzyl-[3-methoxy-2-(methoxymethyl)-2-methylpropyl]amino]methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 59041743 |
| Molecular Formula | C33H42N2O7 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.30 |
| IUPAC Name | ethyl 2-[4-[3-[[benzyl-[3-methoxy-2-(methoxymethyl)-2-methylpropyl]amino]methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc(O)c(CN(Cc3ccccc3)CC(C)(COC)COC)c2)c(C)c1 |
| InChI | InChI=1S/C33H42N2O7/c1-7-41-32(38)31(37)34-27-15-23(2)30(24(3)16-27)42-28-13-14-29(36)26(17-28)19-35(18-25-11-9-8-10-12-25)20-33(4,21-39-5)22-40-6/h8-17,36H,7,18-22H2,1-6H3,(H,34,37) |
| InChIKey | FBGHCMKTMIVIDZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|