C31H36N2O6 — CID 59041833
ethyl 2-[4-[3-[[benzyl(oxolan-2-ylmethyl)amino]methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate (PubChem CID 59041833) has the molecular formula C31H36N2O6 and a molecular weight of 532.64 g/mol. Its IUPAC name is ethyl 2-[4-[3-[[benzyl(oxolan-2-ylmethyl)amino]methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[3-[[benzyl(oxolan-2-ylmethyl)amino]methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 59041833 |
| Molecular Formula | C31H36N2O6 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.26 |
| IUPAC Name | ethyl 2-[4-[3-[[benzyl(oxolan-2-ylmethyl)amino]methyl]-4-hydroxyphenoxy]-3,5-dimethylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc(O)c(CN(Cc3ccccc3)CC3CCCO3)c2)c(C)c1 |
| InChI | InChI=1S/C31H36N2O6/c1-4-37-31(36)30(35)32-25-15-21(2)29(22(3)16-25)39-26-12-13-28(34)24(17-26)19-33(20-27-11-8-14-38-27)18-23-9-6-5-7-10-23/h5-7,9-10,12-13,15-17,27,34H,4,8,11,14,18-20H2,1-3H3,(H,32,35) |
| InChIKey | LYJPJBBYUAZGPI-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|