C28H30N2O6 — CID 59041708
ethyl 2-[4-[4-hydroxy-3-(1-phenylpropylcarbamoyl)phenoxy]-3,5-dimethylanilino]-2-oxoacetate (PubChem CID 59041708) has the molecular formula C28H30N2O6 and a molecular weight of 490.56 g/mol. Its IUPAC name is ethyl 2-[4-[4-hydroxy-3-(1-phenylpropylcarbamoyl)phenoxy]-3,5-dimethylanilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[4-hydroxy-3-(1-phenylpropylcarbamoyl)phenoxy]-3,5-dimethylanilino]-2-oxoacetate |
|---|---|
| PubChem CID | 59041708 |
| Molecular Formula | C28H30N2O6 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | ethyl 2-[4-[4-hydroxy-3-(1-phenylpropylcarbamoyl)phenoxy]-3,5-dimethylanilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1cc(C)c(Oc2ccc(O)c(C(=O)NC(CC)c3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C28H30N2O6/c1-5-23(19-10-8-7-9-11-19)30-26(32)22-16-21(12-13-24(22)31)36-25-17(3)14-20(15-18(25)4)29-27(33)28(34)35-6-2/h7-16,23,31H,5-6H2,1-4H3,(H,29,33)(H,30,32) |
| InChIKey | WISCXGGTVUYQOR-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|