C27H28N2O6 — CID 59041614
[2-[4-[4-hydroxy-3-(2-phenylpropanoylamino)phenoxy]-3,5-dimethylanilino]-2-oxoethyl] acetate (PubChem CID 59041614) has the molecular formula C27H28N2O6 and a molecular weight of 476.53 g/mol. Its IUPAC name is [2-[4-[4-hydroxy-3-(2-phenylpropanoylamino)phenoxy]-3,5-dimethylanilino]-2-oxoethyl] acetate.
| Compound Name | [2-[4-[4-hydroxy-3-(2-phenylpropanoylamino)phenoxy]-3,5-dimethylanilino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 59041614 |
| Molecular Formula | C27H28N2O6 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [2-[4-[4-hydroxy-3-(2-phenylpropanoylamino)phenoxy]-3,5-dimethylanilino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)Nc1cc(C)c(Oc2ccc(O)c(NC(=O)C(C)c3ccccc3)c2)c(C)c1 |
| InChI | InChI=1S/C27H28N2O6/c1-16-12-21(28-25(32)15-34-19(4)30)13-17(2)26(16)35-22-10-11-24(31)23(14-22)29-27(33)18(3)20-8-6-5-7-9-20/h5-14,18,31H,15H2,1-4H3,(H,28,32)(H,29,33) |
| InChIKey | QXMVVBZWNPDGSV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|