C19H24N2O4 — CID 91042264
N-[5-[4-(ethylamino)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-2-methoxyacetamide (PubChem CID 91042264) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[5-[4-(ethylamino)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-2-methoxyacetamide.
| Compound Name | N-[5-[4-(ethylamino)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 91042264 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[5-[4-(ethylamino)-2,6-dimethylphenoxy]-2-hydroxyphenyl]-2-methoxyacetamide |
| SMILES | CCNc1cc(C)c(Oc2ccc(O)c(NC(=O)COC)c2)c(C)c1 |
| InChI | InChI=1S/C19H24N2O4/c1-5-20-14-8-12(2)19(13(3)9-14)25-15-6-7-17(22)16(10-15)21-18(23)11-24-4/h6-10,20,22H,5,11H2,1-4H3,(H,21,23) |
| InChIKey | ZGYJOWIBOBAZSW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|