C22H31N3O3 — CID 59041843
3-[5-(4-amino-2,6-dimethylphenoxy)-2-hydroxyphenyl]-1-hexyl-1-methylurea (PubChem CID 59041843) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 3-[5-(4-amino-2,6-dimethylphenoxy)-2-hydroxyphenyl]-1-hexyl-1-methylurea.
| Compound Name | 3-[5-(4-amino-2,6-dimethylphenoxy)-2-hydroxyphenyl]-1-hexyl-1-methylurea |
|---|---|
| PubChem CID | 59041843 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 3-[5-(4-amino-2,6-dimethylphenoxy)-2-hydroxyphenyl]-1-hexyl-1-methylurea |
| SMILES | CCCCCCN(C)C(=O)Nc1cc(Oc2c(C)cc(N)cc2C)ccc1O |
| InChI | InChI=1S/C22H31N3O3/c1-5-6-7-8-11-25(4)22(27)24-19-14-18(9-10-20(19)26)28-21-15(2)12-17(23)13-16(21)3/h9-10,12-14,26H,5-8,11,23H2,1-4H3,(H,24,27) |
| InChIKey | FGNVGSQYFCELTF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|