C14H19FN2O3 — CID 61199857
5-fluoro-2-[[methyl(pentyl)carbamoyl]amino]benzoic acid (PubChem CID 61199857) has the molecular formula C14H19FN2O3 and a molecular weight of 282.31 g/mol. Its IUPAC name is 5-fluoro-2-[[methyl(pentyl)carbamoyl]amino]benzoic acid.
| Compound Name | 5-fluoro-2-[[methyl(pentyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 61199857 |
| Molecular Formula | C14H19FN2O3 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 5-fluoro-2-[[methyl(pentyl)carbamoyl]amino]benzoic acid |
| SMILES | CCCCCN(C)C(=O)Nc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C14H19FN2O3/c1-3-4-5-8-17(2)14(20)16-12-7-6-10(15)9-11(12)13(18)19/h6-7,9H,3-5,8H2,1-2H3,(H,16,20)(H,18,19) |
| InChIKey | AEYCWULNBGCQQY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|