C15H22FN3O3 — CID 23370111
3-(4-fluoro-2-nitrophenyl)-1-heptyl-1-methylurea (PubChem CID 23370111) has the molecular formula C15H22FN3O3 and a molecular weight of 311.36 g/mol. Its IUPAC name is 3-(4-fluoro-2-nitrophenyl)-1-heptyl-1-methylurea.
| Compound Name | 3-(4-fluoro-2-nitrophenyl)-1-heptyl-1-methylurea |
|---|---|
| PubChem CID | 23370111 |
| Molecular Formula | C15H22FN3O3 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-(4-fluoro-2-nitrophenyl)-1-heptyl-1-methylurea |
| SMILES | CCCCCCCN(C)C(=O)Nc1ccc(F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H22FN3O3/c1-3-4-5-6-7-10-18(2)15(20)17-13-9-8-12(16)11-14(13)19(21)22/h8-9,11H,3-7,10H2,1-2H3,(H,17,20) |
| InChIKey | RNJUOHDFRNDQQV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|