C15H15FN4O6 — CID 3594113
2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-fluoro-2-nitrophenyl)acetamide (PubChem CID 3594113) has the molecular formula C15H15FN4O6 and a molecular weight of 366.31 g/mol. Its IUPAC name is 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-fluoro-2-nitrophenyl)acetamide.
| Compound Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-fluoro-2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 3594113 |
| Molecular Formula | C15H15FN4O6 |
| Molecular Weight | 366.31 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(4-fluoro-2-nitrophenyl)acetamide |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)Nc2ccc(F)cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C15H15FN4O6/c1-2-3-6-18-13(22)14(23)19(15(18)24)8-12(21)17-10-5-4-9(16)7-11(10)20(25)26/h4-5,7H,2-3,6,8H2,1H3,(H,17,21) |
| InChIKey | RCGWZFZCVTXQAD-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|