C17H20N4O6 — CID 7738270
2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,3-dimethyl-6-nitrophenyl)acetamide (PubChem CID 7738270) has the molecular formula C17H20N4O6 and a molecular weight of 376.37 g/mol. Its IUPAC name is 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,3-dimethyl-6-nitrophenyl)acetamide.
| Compound Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,3-dimethyl-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 7738270 |
| Molecular Formula | C17H20N4O6 |
| Molecular Weight | 376.37 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 2-(3-butyl-2,4,5-trioxoimidazolidin-1-yl)-N-(2,3-dimethyl-6-nitrophenyl)acetamide |
| SMILES | CCCCN1C(=O)C(=O)N(CC(=O)Nc2c([N+](=O)[O-])ccc(C)c2C)C1=O |
| InChI | InChI=1S/C17H20N4O6/c1-4-5-8-19-15(23)16(24)20(17(19)25)9-13(22)18-14-11(3)10(2)6-7-12(14)21(26)27/h6-7H,4-5,8-9H2,1-3H3,(H,18,22) |
| InChIKey | DCONXEDSBRFNFJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 129.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|