C12H15FN2O5S — CID 79846761
5-fluoro-2-[[methyl(2-methylsulfonylethyl)carbamoyl]amino]benzoic acid (PubChem CID 79846761) has the molecular formula C12H15FN2O5S and a molecular weight of 318.33 g/mol. Its IUPAC name is 5-fluoro-2-[[methyl(2-methylsulfonylethyl)carbamoyl]amino]benzoic acid.
| Compound Name | 5-fluoro-2-[[methyl(2-methylsulfonylethyl)carbamoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 79846761 |
| Molecular Formula | C12H15FN2O5S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 5-fluoro-2-[[methyl(2-methylsulfonylethyl)carbamoyl]amino]benzoic acid |
| SMILES | CN(CCS(C)(=O)=O)C(=O)Nc1ccc(F)cc1C(=O)O |
| InChI | InChI=1S/C12H15FN2O5S/c1-15(5-6-21(2,19)20)12(18)14-10-4-3-8(13)7-9(10)11(16)17/h3-4,7H,5-6H2,1-2H3,(H,14,18)(H,16,17) |
| InChIKey | IVDFHOKYDSQEMI-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |