C24H32N2O4 — CID 59041729
N-[5-(4-acetamido-2,6-dimethylphenoxy)-2-hydroxyphenyl]-2-propylpentanamide (PubChem CID 59041729) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is N-[5-(4-acetamido-2,6-dimethylphenoxy)-2-hydroxyphenyl]-2-propylpentanamide.
| Compound Name | N-[5-(4-acetamido-2,6-dimethylphenoxy)-2-hydroxyphenyl]-2-propylpentanamide |
|---|---|
| PubChem CID | 59041729 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | N-[5-(4-acetamido-2,6-dimethylphenoxy)-2-hydroxyphenyl]-2-propylpentanamide |
| SMILES | CCCC(CCC)C(=O)Nc1cc(Oc2c(C)cc(NC(C)=O)cc2C)ccc1O |
| InChI | InChI=1S/C24H32N2O4/c1-6-8-18(9-7-2)24(29)26-21-14-20(10-11-22(21)28)30-23-15(3)12-19(13-16(23)4)25-17(5)27/h10-14,18,28H,6-9H2,1-5H3,(H,25,27)(H,26,29) |
| InChIKey | NSOVMRRLDWEVIK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|