C11H17N3O — CID 79152927
3-(4-amino-2-methylphenyl)-1-ethyl-1-methylurea (PubChem CID 79152927) has the molecular formula C11H17N3O and a molecular weight of 207.28 g/mol. Its IUPAC name is 3-(4-amino-2-methylphenyl)-1-ethyl-1-methylurea.
| Compound Name | 3-(4-amino-2-methylphenyl)-1-ethyl-1-methylurea |
|---|---|
| PubChem CID | 79152927 |
| Molecular Formula | C11H17N3O |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.14 |
| IUPAC Name | 3-(4-amino-2-methylphenyl)-1-ethyl-1-methylurea |
| SMILES | CCN(C)C(=O)Nc1ccc(N)cc1C |
| InChI | InChI=1S/C11H17N3O/c1-4-14(3)11(15)13-10-6-5-9(12)7-8(10)2/h5-7H,4,12H2,1-3H3,(H,13,15) |
| InChIKey | SITIWPOXOYHOLX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|