C25H25NO5 — CID 69260442
methyl 3-[4-[4-hydroxy-3-(4-methylphenyl)phenoxy]-3,5-dimethylanilino]-3-oxopropanoate (PubChem CID 69260442) has the molecular formula C25H25NO5 and a molecular weight of 419.48 g/mol. Its IUPAC name is methyl 3-[4-[4-hydroxy-3-(4-methylphenyl)phenoxy]-3,5-dimethylanilino]-3-oxopropanoate.
| Compound Name | methyl 3-[4-[4-hydroxy-3-(4-methylphenyl)phenoxy]-3,5-dimethylanilino]-3-oxopropanoate |
|---|---|
| PubChem CID | 69260442 |
| Molecular Formula | C25H25NO5 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | methyl 3-[4-[4-hydroxy-3-(4-methylphenyl)phenoxy]-3,5-dimethylanilino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1cc(C)c(Oc2ccc(O)c(-c3ccc(C)cc3)c2)c(C)c1 |
| InChI | InChI=1S/C25H25NO5/c1-15-5-7-18(8-6-15)21-13-20(9-10-22(21)27)31-25-16(2)11-19(12-17(25)3)26-23(28)14-24(29)30-4/h5-13,27H,14H2,1-4H3,(H,26,28) |
| InChIKey | VLUCTZJUICFNJP-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|