C23H19Cl2NO5 — CID 22344938
3-[4-[3-(2,4-dichlorophenyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoic acid (PubChem CID 22344938) has the molecular formula C23H19Cl2NO5 and a molecular weight of 460.31 g/mol. Its IUPAC name is 3-[4-[3-(2,4-dichlorophenyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoic acid.
| Compound Name | 3-[4-[3-(2,4-dichlorophenyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoic acid |
|---|---|
| PubChem CID | 22344938 |
| Molecular Formula | C23H19Cl2NO5 |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 3-[4-[3-(2,4-dichlorophenyl)-4-hydroxyphenoxy]-3,5-dimethylanilino]-3-oxopropanoic acid |
| SMILES | Cc1cc(NC(=O)CC(=O)O)cc(C)c1Oc1ccc(O)c(-c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C23H19Cl2NO5/c1-12-7-15(26-21(28)11-22(29)30)8-13(2)23(12)31-16-4-6-20(27)18(10-16)17-5-3-14(24)9-19(17)25/h3-10,27H,11H2,1-2H3,(H,26,28)(H,29,30) |
| InChIKey | YCACHAIJPMCJAB-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|