C21H16Cl2N2O5 — CID 129199001
N-[4-(3-benzyl-4-hydroxyphenoxy)-3,5-dichlorophenyl]-N'-hydroxyoxamide (PubChem CID 129199001) has the molecular formula C21H16Cl2N2O5 and a molecular weight of 447.27 g/mol. Its IUPAC name is N-[4-(3-benzyl-4-hydroxyphenoxy)-3,5-dichlorophenyl]-N'-hydroxyoxamide.
| Compound Name | N-[4-(3-benzyl-4-hydroxyphenoxy)-3,5-dichlorophenyl]-N'-hydroxyoxamide |
|---|---|
| PubChem CID | 129199001 |
| Molecular Formula | C21H16Cl2N2O5 |
| Molecular Weight | 447.27 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | N-[4-(3-benzyl-4-hydroxyphenoxy)-3,5-dichlorophenyl]-N'-hydroxyoxamide |
| SMILES | O=C(NO)C(=O)Nc1cc(Cl)c(Oc2ccc(O)c(Cc3ccccc3)c2)c(Cl)c1 |
| InChI | InChI=1S/C21H16Cl2N2O5/c22-16-10-14(24-20(27)21(28)25-29)11-17(23)19(16)30-15-6-7-18(26)13(9-15)8-12-4-2-1-3-5-12/h1-7,9-11,26,29H,8H2,(H,24,27)(H,25,28) |
| InChIKey | BUMRLWUEGGWSDU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.27 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|