C18H19ClN2O7S — CID 18614129
2-[3-chloro-4-[3-[ethyl(methyl)sulfamoyl]-4-hydroxyphenoxy]-5-methylanilino]-2-oxoacetic acid (PubChem CID 18614129) has the molecular formula C18H19ClN2O7S and a molecular weight of 442.88 g/mol. Its IUPAC name is 2-[3-chloro-4-[3-[ethyl(methyl)sulfamoyl]-4-hydroxyphenoxy]-5-methylanilino]-2-oxoacetic acid.
| Compound Name | 2-[3-chloro-4-[3-[ethyl(methyl)sulfamoyl]-4-hydroxyphenoxy]-5-methylanilino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 18614129 |
| Molecular Formula | C18H19ClN2O7S |
| Molecular Weight | 442.88 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-[3-chloro-4-[3-[ethyl(methyl)sulfamoyl]-4-hydroxyphenoxy]-5-methylanilino]-2-oxoacetic acid |
| SMILES | CCN(C)S(=O)(=O)c1cc(Oc2c(C)cc(NC(=O)C(=O)O)cc2Cl)ccc1O |
| InChI | InChI=1S/C18H19ClN2O7S/c1-4-21(3)29(26,27)15-9-12(5-6-14(15)22)28-16-10(2)7-11(8-13(16)19)20-17(23)18(24)25/h5-9,22H,4H2,1-3H3,(H,20,23)(H,24,25) |
| InChIKey | QMDPCMMXUQKDNF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.88 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|