C20H12Cl2FIN3O4S- — CID 163293629
CID 163293629 (PubChem CID 163293629) has the molecular formula C20H12Cl2FIN3O4S- and a molecular weight of 607.21 g/mol.
| Compound Name | CID 163293629 |
|---|---|
| PubChem CID | 163293629 |
| Molecular Formula | C20H12Cl2FIN3O4S- |
| Molecular Weight | 607.21 g/mol |
| Exact Mass | 605.90 |
| IUPAC Name | — |
| SMILES | O=C1NC(C(=O)Nc2cc(Cl)c(Oc3ccc4c(c3F)C3(CC3)C(=O)N4)c(Cl)c2)=C[I-]S1 |
| InChI | InChI=1S/C20H12Cl2FIN3O4S/c21-9-5-8(25-17(28)12-7-24-32-19(30)27-12)6-10(22)16(9)31-13-2-1-11-14(15(13)23)20(3-4-20)18(29)26-11/h1-2,5-7H,3-4H2,(H,25,28)(H,26,29)(H,27,30)/q-1 |
| InChIKey | IBJMHCVGEOTRSJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.21 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|