C8H4Cl2FN5O — CID 107577373
N-(3,5-dichloro-4-fluorophenyl)-2H-tetrazole-5-carboxamide (PubChem CID 107577373) has the molecular formula C8H4Cl2FN5O and a molecular weight of 276.06 g/mol. Its IUPAC name is N-(3,5-dichloro-4-fluorophenyl)-2H-tetrazole-5-carboxamide.
| Compound Name | N-(3,5-dichloro-4-fluorophenyl)-2H-tetrazole-5-carboxamide |
|---|---|
| PubChem CID | 107577373 |
| Molecular Formula | C8H4Cl2FN5O |
| Molecular Weight | 276.06 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | N-(3,5-dichloro-4-fluorophenyl)-2H-tetrazole-5-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(F)c(Cl)c1)c1nn[nH]n1 |
| InChI | InChI=1S/C8H4Cl2FN5O/c9-4-1-3(2-5(10)6(4)11)12-8(17)7-13-15-16-14-7/h1-2H,(H,12,17)(H,13,14,15,16) |
| InChIKey | PBDFDQDPBDZASS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.06 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|