C12H14ClFN6O — CID 167900175
1-(3-chloro-4-fluoro-5-methylphenyl)-3-[2-(2H-tetrazol-5-yl)propan-2-yl]urea (PubChem CID 167900175) has the molecular formula C12H14ClFN6O and a molecular weight of 312.74 g/mol. Its IUPAC name is 1-(3-chloro-4-fluoro-5-methylphenyl)-3-[2-(2H-tetrazol-5-yl)propan-2-yl]urea.
| Compound Name | 1-(3-chloro-4-fluoro-5-methylphenyl)-3-[2-(2H-tetrazol-5-yl)propan-2-yl]urea |
|---|---|
| PubChem CID | 167900175 |
| Molecular Formula | C12H14ClFN6O |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 1-(3-chloro-4-fluoro-5-methylphenyl)-3-[2-(2H-tetrazol-5-yl)propan-2-yl]urea |
| SMILES | Cc1cc(NC(=O)NC(C)(C)c2nn[nH]n2)cc(Cl)c1F |
| InChI | InChI=1S/C12H14ClFN6O/c1-6-4-7(5-8(13)9(6)14)15-11(21)16-12(2,3)10-17-19-20-18-10/h4-5H,1-3H3,(H2,15,16,21)(H,17,18,19,20) |
| InChIKey | VMWGXMOXTHGSQZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |