C18H16Cl2F4N6O — CID 153184952
1-[[6-(3-amino-4,4,4-trifluoro-1-methyliminobut-2-en-2-yl)-5-methylpyridazin-3-yl]methyl]-3-(3,5-dichloro-4-fluorophenyl)urea (PubChem CID 153184952) has the molecular formula C18H16Cl2F4N6O and a molecular weight of 479.27 g/mol. Its IUPAC name is 1-[[6-(3-amino-4,4,4-trifluoro-1-methyliminobut-2-en-2-yl)-5-methylpyridazin-3-yl]methyl]-3-(3,5-dichloro-4-fluorophenyl)urea.
| Compound Name | 1-[[6-(3-amino-4,4,4-trifluoro-1-methyliminobut-2-en-2-yl)-5-methylpyridazin-3-yl]methyl]-3-(3,5-dichloro-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 153184952 |
| Molecular Formula | C18H16Cl2F4N6O |
| Molecular Weight | 479.27 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | 1-[[6-(3-amino-4,4,4-trifluoro-1-methyliminobut-2-en-2-yl)-5-methylpyridazin-3-yl]methyl]-3-(3,5-dichloro-4-fluorophenyl)urea |
| SMILES | C/N=C/C(=C(N)C(F)(F)F)c1nnc(CNC(=O)Nc2cc(Cl)c(F)c(Cl)c2)cc1C |
| InChI | InChI=1S/C18H16Cl2F4N6O/c1-8-3-10(29-30-15(8)11(7-26-2)16(25)18(22,23)24)6-27-17(31)28-9-4-12(19)14(21)13(20)5-9/h3-5,7H,6,25H2,1-2H3,(H2,27,28,31)/b16-11?,26-7+ |
| InChIKey | JNFKZHDIZFLRBS-CMUAIPIKSA-N |
| XLogP | 4.49 |
| TPSA | 105.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|