C11H14ClF2N3O — CID 114383867
1-(3-amino-2,2-difluoropropyl)-3-(3-chloro-4-methylphenyl)urea (PubChem CID 114383867) has the molecular formula C11H14ClF2N3O and a molecular weight of 277.70 g/mol. Its IUPAC name is 1-(3-amino-2,2-difluoropropyl)-3-(3-chloro-4-methylphenyl)urea.
| Compound Name | 1-(3-amino-2,2-difluoropropyl)-3-(3-chloro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 114383867 |
| Molecular Formula | C11H14ClF2N3O |
| Molecular Weight | 277.70 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 1-(3-amino-2,2-difluoropropyl)-3-(3-chloro-4-methylphenyl)urea |
| SMILES | Cc1ccc(NC(=O)NCC(F)(F)CN)cc1Cl |
| InChI | InChI=1S/C11H14ClF2N3O/c1-7-2-3-8(4-9(7)12)17-10(18)16-6-11(13,14)5-15/h2-4H,5-6,15H2,1H3,(H2,16,17,18) |
| InChIKey | VDTUMCGWBVNHNG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.70 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |