C20H21ClF3N7O3 — CID 137377912
1-[2-chloro-6-(2-methoxyethoxy)-4-pyridinyl]-3-[[5-methyl-6-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]pyridazin-3-yl]methyl]urea (PubChem CID 137377912) has the molecular formula C20H21ClF3N7O3 and a molecular weight of 499.88 g/mol. Its IUPAC name is 1-[2-chloro-6-(2-methoxyethoxy)-4-pyridinyl]-3-[[5-methyl-6-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]pyridazin-3-yl]methyl]urea.
| Compound Name | 1-[2-chloro-6-(2-methoxyethoxy)-4-pyridinyl]-3-[[5-methyl-6-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]pyridazin-3-yl]methyl]urea |
|---|---|
| PubChem CID | 137377912 |
| Molecular Formula | C20H21ClF3N7O3 |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 499.13 |
| IUPAC Name | 1-[2-chloro-6-(2-methoxyethoxy)-4-pyridinyl]-3-[[5-methyl-6-[1-methyl-3-(trifluoromethyl)pyrazol-4-yl]pyridazin-3-yl]methyl]urea |
| SMILES | COCCOc1cc(NC(=O)NCc2cc(C)c(-c3cn(C)nc3C(F)(F)F)nn2)cc(Cl)n1 |
| InChI | InChI=1S/C20H21ClF3N7O3/c1-11-6-13(28-29-17(11)14-10-31(2)30-18(14)20(22,23)24)9-25-19(32)26-12-7-15(21)27-16(8-12)34-5-4-33-3/h6-8,10H,4-5,9H2,1-3H3,(H2,25,26,27,32) |
| InChIKey | LIRIXOFWLZNCEA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|