C11H5Cl3FN3O — CID 107573378
5-chloro-N-(3,5-dichloro-4-fluorophenyl)pyrazine-2-carboxamide (PubChem CID 107573378) has the molecular formula C11H5Cl3FN3O and a molecular weight of 320.54 g/mol. Its IUPAC name is 5-chloro-N-(3,5-dichloro-4-fluorophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-(3,5-dichloro-4-fluorophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107573378 |
| Molecular Formula | C11H5Cl3FN3O |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 318.95 |
| IUPAC Name | 5-chloro-N-(3,5-dichloro-4-fluorophenyl)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(F)c(Cl)c1)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C11H5Cl3FN3O/c12-6-1-5(2-7(13)10(6)15)18-11(19)8-3-17-9(14)4-16-8/h1-4H,(H,18,19) |
| InChIKey | WZDKXBLACSYBCP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|