C11H5Cl4N3O — CID 107371747
5-chloro-N-(2,4,5-trichlorophenyl)pyrazine-2-carboxamide (PubChem CID 107371747) has the molecular formula C11H5Cl4N3O and a molecular weight of 336.99 g/mol. Its IUPAC name is 5-chloro-N-(2,4,5-trichlorophenyl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-(2,4,5-trichlorophenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107371747 |
| Molecular Formula | C11H5Cl4N3O |
| Molecular Weight | 336.99 g/mol |
| Exact Mass | 334.92 |
| IUPAC Name | 5-chloro-N-(2,4,5-trichlorophenyl)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1cc(Cl)c(Cl)cc1Cl)c1cnc(Cl)cn1 |
| InChI | InChI=1S/C11H5Cl4N3O/c12-5-1-7(14)8(2-6(5)13)18-11(19)9-3-17-10(15)4-16-9/h1-4H,(H,18,19) |
| InChIKey | RPGVAPWCNYHINB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.99 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|