C14H13ClN4O2 — CID 107246307
5-chloro-N-[2-methyl-5-(methylcarbamoyl)phenyl]pyrazine-2-carboxamide (PubChem CID 107246307) has the molecular formula C14H13ClN4O2 and a molecular weight of 304.74 g/mol. Its IUPAC name is 5-chloro-N-[2-methyl-5-(methylcarbamoyl)phenyl]pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-[2-methyl-5-(methylcarbamoyl)phenyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107246307 |
| Molecular Formula | C14H13ClN4O2 |
| Molecular Weight | 304.74 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 5-chloro-N-[2-methyl-5-(methylcarbamoyl)phenyl]pyrazine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(C)c(NC(=O)c2cnc(Cl)cn2)c1 |
| InChI | InChI=1S/C14H13ClN4O2/c1-8-3-4-9(13(20)16-2)5-10(8)19-14(21)11-6-18-12(15)7-17-11/h3-7H,1-2H3,(H,16,20)(H,19,21) |
| InChIKey | GQFBAEGSHVPIJV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |