C14H14ClN3O2 — CID 107246554
5-chloro-N-(3-methoxy-2,4-dimethylphenyl)pyrazine-2-carboxamide (PubChem CID 107246554) has the molecular formula C14H14ClN3O2 and a molecular weight of 291.74 g/mol. Its IUPAC name is 5-chloro-N-(3-methoxy-2,4-dimethylphenyl)pyrazine-2-carboxamide.
| Compound Name | 5-chloro-N-(3-methoxy-2,4-dimethylphenyl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107246554 |
| Molecular Formula | C14H14ClN3O2 |
| Molecular Weight | 291.74 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 5-chloro-N-(3-methoxy-2,4-dimethylphenyl)pyrazine-2-carboxamide |
| SMILES | COc1c(C)ccc(NC(=O)c2cnc(Cl)cn2)c1C |
| InChI | InChI=1S/C14H14ClN3O2/c1-8-4-5-10(9(2)13(8)20-3)18-14(19)11-6-17-12(15)7-16-11/h4-7H,1-3H3,(H,18,19) |
| InChIKey | ZYUWHOAGXFMGGY-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.74 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |