C10H4Cl3N3O3 — CID 62097953
2-chloro-6-(2,6-dichloro-4-nitrophenoxy)pyrazine (PubChem CID 62097953) has the molecular formula C10H4Cl3N3O3 and a molecular weight of 320.52 g/mol. Its IUPAC name is 2-chloro-6-(2,6-dichloro-4-nitrophenoxy)pyrazine.
| Compound Name | 2-chloro-6-(2,6-dichloro-4-nitrophenoxy)pyrazine |
|---|---|
| PubChem CID | 62097953 |
| Molecular Formula | C10H4Cl3N3O3 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 2-chloro-6-(2,6-dichloro-4-nitrophenoxy)pyrazine |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Oc2cncc(Cl)n2)c(Cl)c1 |
| InChI | InChI=1S/C10H4Cl3N3O3/c11-6-1-5(16(17)18)2-7(12)10(6)19-9-4-14-3-8(13)15-9/h1-4H |
| InChIKey | OVDJMMCJINEHIM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|