C17H21N5 — CID 172808417
6-N,9-N-bis(2-aminoethyl)-5,10-dideuteriobenzo[g]isoquinoline-6,9-diamine (PubChem CID 172808417) has the molecular formula C17H21N5 and a molecular weight of 297.40 g/mol. Its IUPAC name is 6-N,9-N-bis(2-aminoethyl)-5,10-dideuteriobenzo[g]isoquinoline-6,9-diamine.
| Compound Name | 6-N,9-N-bis(2-aminoethyl)-5,10-dideuteriobenzo[g]isoquinoline-6,9-diamine |
|---|---|
| PubChem CID | 172808417 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 6-N,9-N-bis(2-aminoethyl)-5,10-dideuteriobenzo[g]isoquinoline-6,9-diamine |
| SMILES | [2H]c1c2ccncc2c([2H])c2c(NCCN)ccc(NCCN)c12 |
| InChI | InChI=1S/C17H21N5/c18-4-7-21-16-1-2-17(22-8-5-19)15-10-13-11-20-6-3-12(13)9-14(15)16/h1-3,6,9-11,21-22H,4-5,7-8,18-19H2/i9D,10D |
| InChIKey | RVHSBUBNTMSDAI-QDRJLNDYSA-N |
| XLogP | 2.13 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|